What is the molecular formula of 4-Tetradecylaniline?
The molecular formula of 4-Tetradecylaniline is C20H35N.
What is the molecular weight of 4-Tetradecylaniline?
The molecular weight of 4-Tetradecylaniline is 289.5 g/mol.
What is the IUPAC name of 4-Tetradecylaniline?
The IUPAC name of 4-Tetradecylaniline is 4-tetradecylaniline.
What is the InChI of 4-Tetradecylaniline?
The InChI of 4-Tetradecylaniline is InChI=1S/C20H35N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-15-17-20(21)18-16-19/h15-18H,2-14,21H2,1H3.
What is the InChIKey of 4-Tetradecylaniline?
The InChIKey of 4-Tetradecylaniline is WKYFQPQIOXXPGE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Tetradecylaniline?
The canonical SMILES of 4-Tetradecylaniline is CCCCCCCCCCCCCCC1=CC=C(C=C1)N.
What is the CAS number of 4-Tetradecylaniline?
The CAS number of 4-Tetradecylaniline is 91323-12-5.
What is the European Community (EC) Number of 4-Tetradecylaniline?
The European Community (EC) Number of 4-Tetradecylaniline is 629-156-3.
What is the DSSTox Substance ID of 4-Tetradecylaniline?
The DSSTox Substance ID of 4-Tetradecylaniline is DTXSID50238518.
Is 4-Tetradecylaniline a canonicalized compound?
Yes, 4-Tetradecylaniline is a canonicalized compound.