What is the molecular formula of 4-Piperazine-piperidine?
The molecular formula is C9H19N3.
What are the synonyms of 4-Piperazine-piperidine?
The synonyms are 1-(piperidin-4-yl)piperazine, 142013-66-9, Piperazine, 1-(4-piperidinyl)-, and 1-(4-Piperidyl)piperazine.
What is the molecular weight of 4-Piperazine-piperidine?
The molecular weight is 169.27 g/mol.
How was the molecular weight computed?
The molecular weight was computed by PubChem 2.1.
When was 4-Piperazine-piperidine created?
It was created on February 9, 2007.
When was 4-Piperazine-piperidine last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of 4-Piperazine-piperidine?
The IUPAC name is 1-piperidin-4-ylpiperazine.
What is the InChI of 4-Piperazine-piperidine?
The InChI is InChI=1S/C9H19N3/c1-3-10-4-2-9(1)12-7-5-11-6-8-12/h9-11H,1-8H2.
What is the InChIKey of 4-Piperazine-piperidine?
The InChIKey is ZHYYBDZASCMDMP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Piperazine-piperidine?
The canonical SMILES is C1CNCCC1N2CCNCC2.