What is the molecular formula of 1-Phenyl-3-buten-1-ol?
The molecular formula of 1-Phenyl-3-buten-1-ol is C10H12O.
What is the molecular weight of 1-Phenyl-3-buten-1-ol?
The molecular weight of 1-Phenyl-3-buten-1-ol is 148.20 g/mol.
What is the IUPAC name of 1-Phenyl-3-buten-1-ol?
The IUPAC name of 1-Phenyl-3-buten-1-ol is 1-phenylbut-3-en-1-ol.
What is the InChI of 1-Phenyl-3-buten-1-ol?
The InChI of 1-Phenyl-3-buten-1-ol is InChI=1S/C10H12O/c1-2-6-10(11)9-7-4-3-5-8-9/h2-5,7-8,10-11H,1,6H2.
What is the InChIKey of 1-Phenyl-3-buten-1-ol?
The InChIKey of 1-Phenyl-3-buten-1-ol is RGKVZBXSJFAZRE-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Phenyl-3-buten-1-ol?
The canonical SMILES of 1-Phenyl-3-buten-1-ol is C=CCC(C1=CC=CC=C1)O.
What is the CAS number of 1-Phenyl-3-buten-1-ol?
The CAS number of 1-Phenyl-3-buten-1-ol is 936-58-3.
What is the XLogP3-AA value of 1-Phenyl-3-buten-1-ol?
The XLogP3-AA value of 1-Phenyl-3-buten-1-ol is 2.2.
How many hydrogen bond donor counts does 1-Phenyl-3-buten-1-ol have?
1-Phenyl-3-buten-1-ol has 1 hydrogen bond donor count.
How many rotatable bond counts does 1-Phenyl-3-buten-1-ol have?
1-Phenyl-3-buten-1-ol has 3 rotatable bond counts.