What is the molecular formula of 4-Phenoxyacetophenone?
The molecular formula of 4-Phenoxyacetophenone is C14H12O2.
What is the molecular weight of 4-Phenoxyacetophenone?
The molecular weight of 4-Phenoxyacetophenone is 212.24 g/mol.
What is the IUPAC name of 4-Phenoxyacetophenone?
The IUPAC name of 4-Phenoxyacetophenone is 1-(4-phenoxyphenyl)ethanone.
What is the InChI of 4-Phenoxyacetophenone?
The InChI of 4-Phenoxyacetophenone is InChI=1S/C14H12O2/c1-11(15)12-7-9-14(10-8-12)16-13-5-3-2-4-6-13/h2-10H,1H3.
What is the InChIKey of 4-Phenoxyacetophenone?
The InChIKey of 4-Phenoxyacetophenone is DJNIFZYQFLFGDT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Phenoxyacetophenone?
The canonical SMILES of 4-Phenoxyacetophenone is CC(=O)C1=CC=C(C=C1)OC2=CC=CC=C2.
What is the CAS number of 4-Phenoxyacetophenone?
The CAS number of 4-Phenoxyacetophenone is 5031-78-7.
What is the XLogP3 value of 4-Phenoxyacetophenone?
The XLogP3 value of 4-Phenoxyacetophenone is 3.4.
How many hydrogen bond donor counts does 4-Phenoxyacetophenone have?
4-Phenoxyacetophenone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Phenoxyacetophenone have?
4-Phenoxyacetophenone has 2 hydrogen bond acceptor counts.