What is the PubChem CID of 4-Pentylbromobenzene?
PubChem CID 2735599.
What is the molecular formula of 4-Pentylbromobenzene?
The molecular formula is C11H15Br.
What are some synonyms of 4-Pentylbromobenzene?
Some synonyms include 1-Bromo-4-pentylbenzene, 4-bromo-n-pentylbenzene, and 4-n-amylbromobenzene.
What is the molecular weight of 4-Pentylbromobenzene?
The molecular weight is 227.14 g/mol.
What is the IUPAC name of 4-Pentylbromobenzene?
The IUPAC name is 1-bromo-4-pentylbenzene.
What is the InChI of 4-Pentylbromobenzene?
The InChI is InChI=1S/C11H15Br/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9H,2-5H2,1H3.
What is the InChIKey of 4-Pentylbromobenzene?
The InChIKey is SGCJPYYTVBHQGE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Pentylbromobenzene?
The canonical SMILES is CCCCCC1=CC=C(C=C1)Br.
What is the CAS number of 4-Pentylbromobenzene?
The CAS number is 51554-95-1.
Is 4-Pentylbromobenzene a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.