What is the molecular formula of 4-Octylaniline?
The molecular formula of 4-Octylaniline is C14H23N.
What is the molecular weight of 4-Octylaniline?
The molecular weight of 4-Octylaniline is 205.34 g/mol.
What is the IUPAC name of 4-Octylaniline?
The IUPAC name of 4-Octylaniline is 4-octylaniline.
What is the InChI of 4-Octylaniline?
The InChI of 4-Octylaniline is InChI=1S/C14H23N/c1-2-3-4-5-6-7-8-13-9-11-14(15)12-10-13/h9-12H,2-8,15H2,1H3.
What is the InChIKey of 4-Octylaniline?
The InChIKey of 4-Octylaniline is ORKQJTBYQZITLA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Octylaniline?
The canonical SMILES of 4-Octylaniline is CCCCCCCCC1=CC=C(C=C1)N.
What is the CAS number of 4-Octylaniline?
The CAS number of 4-Octylaniline is 16245-79-7.
What is the European Community (EC) number of 4-Octylaniline?
The European Community (EC) number of 4-Octylaniline is 240-358-7.
What is the UNII of 4-Octylaniline?
The UNII of 4-Octylaniline is O9FN212WZZ.
Is 4-Octylaniline a canonicalized compound?
Yes, 4-Octylaniline is a canonicalized compound.