What is the PubChem CID of 4-Nitrophenylethylamine hydrobromide?
PubChem CID 23453301.
What is the chemical structure of 4-Nitrophenylethylamine hydrobromide?
The chemical structure of 4-Nitrophenylethylamine hydrobromide is not provided in the reference.
What is the molecular formula of 4-Nitrophenylethylamine hydrobromide?
The molecular formula of 4-Nitrophenylethylamine hydrobromide is C8H11BrN2O2.
What are the synonyms of 4-Nitrophenylethylamine hydrobromide?
The synonyms of 4-Nitrophenylethylamine hydrobromide are 69447-84-3, 4-Nitrophenylethylamine HBr, 2-(4-nitrophenyl)ethan-1-amine hydrobromide, and 2-(4-nitrophenyl)ethanamine;hydrobromide.
What is the molecular weight of 4-Nitrophenylethylamine hydrobromide?
The molecular weight of 4-Nitrophenylethylamine hydrobromide is 247.09 g/mol.
What is the IUPAC name of 4-Nitrophenylethylamine hydrobromide?
The IUPAC name of 4-Nitrophenylethylamine hydrobromide is 2-(4-nitrophenyl)ethanamine;hydrobromide.
What is the InChI of 4-Nitrophenylethylamine hydrobromide?
The InChI of 4-Nitrophenylethylamine hydrobromide is InChI=1S/C8H10N2O2.BrH/c9-6-5-7-1-3-8(4-2-7)10(11)12;/h1-4H,5-6,9H2;1H.
What is the InChIKey of 4-Nitrophenylethylamine hydrobromide?
The InChIKey of 4-Nitrophenylethylamine hydrobromide is IXEDXMYYHOYVRD-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Nitrophenylethylamine hydrobromide?
The canonical SMILES of 4-Nitrophenylethylamine hydrobromide is C1=CC(=CC=C1CCN)[N+](=O)[O-].Br.
What is the CAS number of 4-Nitrophenylethylamine hydrobromide?
The CAS number of 4-Nitrophenylethylamine hydrobromide is 69447-84-3.
※ Please kindly note that our products are for research use only.