What is the PubChem CID of 4-Nitrodiphenylamine?
The PubChem CID of 4-Nitrodiphenylamine is 13271.
What is the molecular formula of 4-Nitrodiphenylamine?
The molecular formula of 4-Nitrodiphenylamine is C12H10N2O2.
What is the molecular weight of 4-Nitrodiphenylamine?
The molecular weight of 4-Nitrodiphenylamine is 214.22 g/mol.
What is the IUPAC name of 4-Nitrodiphenylamine?
The IUPAC name of 4-Nitrodiphenylamine is 4-nitro-N-phenylaniline.
What is the InChI of 4-Nitrodiphenylamine?
The InChI of 4-Nitrodiphenylamine is InChI=1S/C12H10N2O2/c15-14(16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13H.
What is the InChIKey of 4-Nitrodiphenylamine?
The InChIKey of 4-Nitrodiphenylamine is XXYMSQQCBUKFHE-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Nitrodiphenylamine?
The Canonical SMILES of 4-Nitrodiphenylamine is C1=CC=C(C=C1)NC2=CC=C(C=C2)[N+](=O)[O-].
What is the CAS number of 4-Nitrodiphenylamine?
The CAS number of 4-Nitrodiphenylamine is 836-30-6.
What is the European Community (EC) number of 4-Nitrodiphenylamine?
The European Community (EC) number of 4-Nitrodiphenylamine is 212-646-2.
What is the ChEMBL ID of 4-Nitrodiphenylamine?
The ChEMBL ID of 4-Nitrodiphenylamine is CHEMBL1323785.