What is the molecular formula of 4-Methyl-1-pentyn-3-ol?
The molecular formula of 4-Methyl-1-pentyn-3-ol is C6H10O.
What is the molecular weight of 4-Methyl-1-pentyn-3-ol?
The molecular weight of 4-Methyl-1-pentyn-3-ol is 98.14 g/mol.
What is the IUPAC name of 4-Methyl-1-pentyn-3-ol?
The IUPAC name of 4-Methyl-1-pentyn-3-ol is 4-methylpent-1-yn-3-ol.
What is the InChI code of 4-Methyl-1-pentyn-3-ol?
The InChI code of 4-Methyl-1-pentyn-3-ol is InChI=1S/C6H10O/c1-4-6(7)5(2)3/h1,5-7H,2-3H3.
What is the InChIKey of 4-Methyl-1-pentyn-3-ol?
The InChIKey of 4-Methyl-1-pentyn-3-ol is UTIFIONYBLSHIL-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Methyl-1-pentyn-3-ol?
The Canonical SMILES of 4-Methyl-1-pentyn-3-ol is CC(C)C(C#C)O.
What is the CAS number of 4-Methyl-1-pentyn-3-ol?
The CAS number of 4-Methyl-1-pentyn-3-ol is 565-68-4.
What is the European Community (EC) Number of 4-Methyl-1-pentyn-3-ol?
The European Community (EC) Number of 4-Methyl-1-pentyn-3-ol is 209-287-9.
What is the DSSTox Substance ID of 4-Methyl-1-pentyn-3-ol?
The DSSTox Substance ID of 4-Methyl-1-pentyn-3-ol is DTXSID201031797.
Is 4-Methyl-1-pentyn-3-ol a canonicalized compound?
Yes, 4-Methyl-1-pentyn-3-ol is a canonicalized compound according to PubChem.