What is the molecular formula of 4-Methyl-1-hexanol?
The molecular formula of 4-Methyl-1-hexanol is C7H16O.
What is the molecular weight of 4-Methyl-1-hexanol?
The molecular weight of 4-Methyl-1-hexanol is 116.20 g/mol.
What is the IUPAC name of 4-Methyl-1-hexanol?
The IUPAC name of 4-Methyl-1-hexanol is 4-methylhexan-1-ol.
What is the InChI of 4-Methyl-1-hexanol?
The InChI of 4-Methyl-1-hexanol is InChI=1S/C7H16O/c1-3-7(2)5-4-6-8/h7-8H,3-6H2,1-2H3.
What is the InChIKey of 4-Methyl-1-hexanol?
The InChIKey of 4-Methyl-1-hexanol is YNPVNLWKVZZBTM-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methyl-1-hexanol?
The canonical SMILES of 4-Methyl-1-hexanol is CCC(C)CCCO.
What is the CAS number of 4-Methyl-1-hexanol?
The CAS number of 4-Methyl-1-hexanol is 818-49-5.
What is the XLogP3-AA value of 4-Methyl-1-hexanol?
The XLogP3-AA value of 4-Methyl-1-hexanol is 2.1.
How many rotatable bonds does 4-Methyl-1-hexanol have?
4-Methyl-1-hexanol has 4 rotatable bonds.
Is 4-Methyl-1-hexanol a canonicalized compound?
Yes, 4-Methyl-1-hexanol is a canonicalized compound according to PubChem.