What is the PubChem CID of 4-Isopropylphenethylamine hydrochloride?
The PubChem CID of 4-Isopropylphenethylamine hydrochloride is 3045699.
What is the molecular formula of 4-Isopropylphenethylamine hydrochloride?
The molecular formula of 4-Isopropylphenethylamine hydrochloride is C11H18ClN.
What are the synonyms of 4-Isopropylphenethylamine hydrochloride?
The synonyms of 4-Isopropylphenethylamine hydrochloride include Benzeneethanamine, 4-(1-methylethyl)-, hydrochloride; 2-(4-propan-2-ylphenyl)ethanamine; hydrochloride; and p-Isopropylphenethylamine hydrochloride.
What is the molecular weight of 4-Isopropylphenethylamine hydrochloride?
The molecular weight of 4-Isopropylphenethylamine hydrochloride is 199.72 g/mol.
What is the parent compound of 4-Isopropylphenethylamine hydrochloride?
The parent compound of 4-Isopropylphenethylamine hydrochloride is CID 410082 (2-(4-Isopropylphenyl)ethanamine).
What is the IUPAC name of 4-Isopropylphenethylamine hydrochloride?
The IUPAC name of 4-Isopropylphenethylamine hydrochloride is 2-(4-propan-2-ylphenyl)ethanamine;hydrochloride.
What is the InChI of 4-Isopropylphenethylamine hydrochloride?
The InChI of 4-Isopropylphenethylamine hydrochloride is InChI=1S/C11H17N.ClH/c1-9(2)11-5-3-10(4-6-11)7-8-12;/h3-6,9H,7-8,12H2,1-2H3;1H.
What is the InChIKey of 4-Isopropylphenethylamine hydrochloride?
The InChIKey of 4-Isopropylphenethylamine hydrochloride is NWRYIWFBCRAGSR-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Isopropylphenethylamine hydrochloride?
The canonical SMILES of 4-Isopropylphenethylamine hydrochloride is CC(C)C1=CC=C(C=C1)CCN.Cl.
What is the CAS number of 4-Isopropylphenethylamine hydrochloride?
The CAS number of 4-Isopropylphenethylamine hydrochloride is 61035-87-8.
※ Please kindly note that our products are for research use only.