What is the molecular formula of 4-Iodobenzyl alcohol?
The molecular formula of 4-Iodobenzyl alcohol is C7H7IO.
What is the molecular weight of 4-Iodobenzyl alcohol?
The molecular weight of 4-Iodobenzyl alcohol is 234.03 g/mol.
What is the IUPAC name of 4-Iodobenzyl alcohol?
The IUPAC name of 4-Iodobenzyl alcohol is (4-iodophenyl)methanol.
What is the InChI of 4-Iodobenzyl alcohol?
The InChI of 4-Iodobenzyl alcohol is InChI=1S/C7H7IO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2.
What is the InChIKey of 4-Iodobenzyl alcohol?
The InChIKey of 4-Iodobenzyl alcohol is CNQRHSZYVFYOIE-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Iodobenzyl alcohol?
The Canonical SMILES of 4-Iodobenzyl alcohol is C1=CC(=CC=C1CO)I.
What is the CAS number of 4-Iodobenzyl alcohol?
The CAS number of 4-Iodobenzyl alcohol is 18282-51-4.
What is the European Community (EC) Number of 4-Iodobenzyl alcohol?
The European Community (EC) Number of 4-Iodobenzyl alcohol is 627-655-0.
What is the DSSTox Substance ID of 4-Iodobenzyl alcohol?
The DSSTox Substance ID of 4-Iodobenzyl alcohol is DTXSID90171339.
Is 4-Iodobenzyl alcohol a canonicalized compound?
Yes, 4-Iodobenzyl alcohol is a canonicalized compound.