What is the PubChem CID for 4-Iodo-2-methylaniline?
PubChem CID 83221.
What is the molecular formula of 4-Iodo-2-methylaniline?
The molecular formula is C7H8IN.
What is the molecular weight of 4-Iodo-2-methylaniline?
The molecular weight is 233.05 g/mol.
What is the IUPAC name of 4-Iodo-2-methylaniline?
The IUPAC name is 4-iodo-2-methylaniline.
What is the InChI of 4-Iodo-2-methylaniline?
The InChI is InChI=1S/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3.
What is the InChIKey of 4-Iodo-2-methylaniline?
The InChIKey is BGKLFAQCHHCZRZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Iodo-2-methylaniline?
The canonical SMILES is CC1=C(C=CC(=C1)I)N.
What is the CAS number of 4-Iodo-2-methylaniline?
The CAS number is 13194-68-8.
What is the European Community (EC) number of 4-Iodo-2-methylaniline?
The European Community (EC) number is 236-154-2.
Is 4-Iodo-2-methylaniline a covalently-bonded unit?
Yes, it is a covalently-bonded unit.