What is the PubChem CID of 4-Hydroxyphenyl benzoate?
PubChem CID of 4-Hydroxyphenyl benzoate is 75549.
What is the molecular formula of 4-Hydroxyphenyl benzoate?
The molecular formula of 4-Hydroxyphenyl benzoate is C13H10O3.
What is the synonym for 4-Hydroxyphenyl benzoate?
The synonym for 4-Hydroxyphenyl benzoate is Hydroquinone monobenzoate.
What is the molecular weight of 4-Hydroxyphenyl benzoate?
The molecular weight of 4-Hydroxyphenyl benzoate is 214.22 g/mol.
What is the IUPAC name of 4-Hydroxyphenyl benzoate?
The IUPAC name of 4-Hydroxyphenyl benzoate is (4-hydroxyphenyl) benzoate.
What is the InChI of 4-Hydroxyphenyl benzoate?
The InChI of 4-Hydroxyphenyl benzoate is InChI=1S/C13H10O3/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9,14H.
What is the InChIKey of 4-Hydroxyphenyl benzoate?
The InChIKey of 4-Hydroxyphenyl benzoate is JFAXJRJMFOACBO-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Hydroxyphenyl benzoate?
The canonical SMILES of 4-Hydroxyphenyl benzoate is C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)O.
What is the CAS number of 4-Hydroxyphenyl benzoate?
The CAS number of 4-Hydroxyphenyl benzoate is 2444-19-1.
What is the European Community (EC) number of 4-Hydroxyphenyl benzoate?
The European Community (EC) number of 4-Hydroxyphenyl benzoate is 219-479-4.