What is the molecular formula of 4-(2-Bromoethyl)phenol?
The molecular formula is C8H9BrO.
What is the molecular weight of 4-(2-Bromoethyl)phenol?
The molecular weight is 201.06 g/mol.
What is the IUPAC name of 4-(2-Bromoethyl)phenol?
The IUPAC name is 4-(2-bromoethyl)phenol.
What is the InChI of 4-(2-Bromoethyl)phenol?
The InChI is InChI=1S/C8H9BrO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6H2.
What is the InChIKey of 4-(2-Bromoethyl)phenol?
The InChIKey is DYYVTFCYVZEQDG-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(2-Bromoethyl)phenol?
The canonical SMILES is C1=CC(=CC=C1CCBr)O.
What is the CAS number of 4-(2-Bromoethyl)phenol?
The CAS number is 14140-15-9.
What is the ChEMBL ID of 4-(2-Bromoethyl)phenol?
The ChEMBL ID is CHEMBL24838.
What is the XLogP3 value of 4-(2-Bromoethyl)phenol?
The XLogP3 value is 2.8.
Is 4-(2-Bromoethyl)phenol a canonicalized compound?
Yes, 4-(2-Bromoethyl)phenol is a canonicalized compound.