What is the PubChem CID for 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
PubChem CID 3670479.
What is the molecular formula of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The molecular formula is C6H4ClNO5S.
What are the synonyms for 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The synonyms are 4-hydroxy-3-nitrobenzenesulfonyl chloride, 147682-51-7, 4-hydroxy-3-nitrobenzene-1-sulfonyl chloride, and Benzenesulfonyl chloride, 4-hydroxy-3-nitro-.
What is the molecular weight of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The molecular weight is 237.62 g/mol.
When was 4-Hydroxy-3-nitrobenzenesulfonyl chloride created?
It was created on September 10, 2005.
What is the IUPAC name of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The IUPAC name is 4-hydroxy-3-nitrobenzenesulfonyl chloride.
What is the InChI of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The InChI is "InChI=1S/C6H4ClNO5S/c7-14(12,13)4-1-2-6(9)5(3-4)8(10)11/h1-3,9H".
What is the InChIKey of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The InChIKey is "FRIDVSSBTNZNJD-UHFFFAOYSA-N".
What is the canonical SMILES of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The canonical SMILES is "C1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])O".
What is the CAS number of 4-Hydroxy-3-nitrobenzenesulfonyl chloride?
The CAS number is 147682-51-7.
※ Please kindly note that our products are for research use only.