What is the molecular formula of 4-Hydroperoxy cyclophosphamide?
The molecular formula of 4-Hydroperoxy cyclophosphamide is C7H15Cl2N2O4P.
What is the molecular weight of 4-Hydroperoxy cyclophosphamide?
The molecular weight of 4-Hydroperoxy cyclophosphamide is 293.08 g/mol.
What are some synonyms for 4-Hydroperoxy cyclophosphamide?
Some synonyms for 4-Hydroperoxy cyclophosphamide include 4-Hydroperoxycyclophosphamide, 4-Hydroperoxycyclofosfamide, and 4-OOH Cyclophosphamide.
What is the role of 4-Hydroperoxy cyclophosphamide?
The role of 4-Hydroperoxy cyclophosphamide includes being an antineoplastic agent, an immunosuppressive agent, an alkylating agent, a metabolite, and a drug allergen.
What is the IUPAC name of 4-Hydroperoxy cyclophosphamide?
The IUPAC name of 4-Hydroperoxy cyclophosphamide is N,N-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
What is the Canonical SMILES representation of 4-Hydroperoxy cyclophosphamide?
The Canonical SMILES representation of 4-Hydroperoxy cyclophosphamide is C1COP(=O)(NC1OO)N(CCCl)CCCl.
What is the InChIKey of 4-Hydroperoxy cyclophosphamide?
The InChIKey of 4-Hydroperoxy cyclophosphamide is VPAWVRUHMJVRHU-UHFFFAOYSA-N.
What is the CAS number for 4-Hydroperoxy cyclophosphamide?
The CAS number for 4-Hydroperoxy cyclophosphamide is 39800-16-3.
What is the hydrogen bond donor count of 4-Hydroperoxy cyclophosphamide?
The hydrogen bond donor count of 4-Hydroperoxy cyclophosphamide is 2.
What is the topological polar surface area of 4-Hydroperoxy cyclophosphamide?
The topological polar surface area of 4-Hydroperoxy cyclophosphamide is 71.2.
※ Please kindly note that our products are for research use only.