What is the PubChem CID of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The PubChem CID is 21253979.
What is the molecular formula of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The molecular formula is C13H19BN2O3.
What are some synonyms of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
Some synonyms include 276694-16-7, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide, and 4-(Hydrazinecarbonyl)phenylboronic acid, pinacol ester.
What is the molecular weight of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The molecular weight is 262.11 g/mol.
When was 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester created?
It was created on December 5, 2007.
When was 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester last modified?
It was last modified on December 2, 2023.
What is the IUPAC Name of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The IUPAC Name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzohydrazide.
What is the InChI of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The InChI is InChI=1S/C13H19BN2O3/c1-12(2)13(3,4)19-14(18-12)10-7-5-9(6-8-10)11(17)16-15/h5-8H,15H2,1-4H3,(H,16,17).
What is the InChIKey of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The InChIKey is GFZSUVMUIACQHK-UHFFFAOYSA-N.
What is the canonical SMILES of 4-(Hydrazinocarbonyl)benzeneboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NN.
※ Please kindly note that our products are for research use only.