What is the molecular formula of 4-Fluorothiophenol?
The molecular formula of 4-Fluorothiophenol is C6H5FS.
What is the molecular weight of 4-Fluorothiophenol?
The molecular weight of 4-Fluorothiophenol is 128.17 g/mol.
What is the IUPAC name of 4-Fluorothiophenol?
The IUPAC name of 4-Fluorothiophenol is 4-fluorobenzenethiol.
What is the InChI of 4-Fluorothiophenol?
The InChI of 4-Fluorothiophenol is InChI=1S/C6H5FS/c7-5-1-3-6(8)4-2-5/h1-4,8H.
What is the InChIKey of 4-Fluorothiophenol?
The InChIKey of 4-Fluorothiophenol is OKIHXNKYYGUVTE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluorothiophenol?
The canonical SMILES of 4-Fluorothiophenol is C1=CC(=CC=C1F)S.
What is the CAS number of 4-Fluorothiophenol?
The CAS number of 4-Fluorothiophenol is 371-42-6.
What is the European Community (EC) number of 4-Fluorothiophenol?
The European Community (EC) number of 4-Fluorothiophenol is 206-737-6.
What is the ChEMBL ID of 4-Fluorothiophenol?
The ChEMBL ID of 4-Fluorothiophenol is CHEMBL333626.
Is 4-Fluorothiophenol a canonicalized compound?
Yes, 4-Fluorothiophenol is a canonicalized compound.