What is the molecular formula of 4-Fluorosalicylic acid?
The molecular formula of 4-Fluorosalicylic acid is C7H5FO3.
What is the molecular weight of 4-Fluorosalicylic acid?
The molecular weight of 4-Fluorosalicylic acid is 156.11 g/mol.
What is the IUPAC name of 4-Fluorosalicylic acid?
The IUPAC name of 4-Fluorosalicylic acid is 4-fluoro-2-hydroxybenzoic acid.
What is the InChI of 4-Fluorosalicylic acid?
The InChI of 4-Fluorosalicylic acid is InChI=1S/C7H5FO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,(H,10,11).
What is the InChIKey of 4-Fluorosalicylic acid?
The InChIKey of 4-Fluorosalicylic acid is TTZOLDXHOCCNMF-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Fluorosalicylic acid?
The Canonical SMILES of 4-Fluorosalicylic acid is C1=CC(=C(C=C1F)O)C(=O)O.
What is the CAS number of 4-Fluorosalicylic acid?
The CAS number of 4-Fluorosalicylic acid is 345-29-9.
What is the European Community (EC) number of 4-Fluorosalicylic acid?
The European Community (EC) number of 4-Fluorosalicylic acid is 206-459-5.
What is the ChEMBL ID of 4-Fluorosalicylic acid?
The ChEMBL ID of 4-Fluorosalicylic acid is CHEMBL1650626.
Is 4-Fluorosalicylic acid a canonicalized compound?
Yes, 4-Fluorosalicylic acid is a canonicalized compound according to PubChem.