What is the molecular formula of 4-Fluoroiodobenzene?
The molecular formula of 4-Fluoroiodobenzene is C6H4FI.
What is the molecular weight of 4-Fluoroiodobenzene?
The molecular weight of 4-Fluoroiodobenzene is 222.00 g/mol.
What is the IUPAC name of 4-Fluoroiodobenzene?
The IUPAC name of 4-Fluoroiodobenzene is 1-fluoro-4-iodobenzene.
What is the InChI code of 4-Fluoroiodobenzene?
The InChI code of 4-Fluoroiodobenzene is InChI=1S/C6H4FI/c7-5-1-3-6(8)4-2-5/h1-4H.
What is the InChIKey of 4-Fluoroiodobenzene?
The InChIKey of 4-Fluoroiodobenzene is KGNQDBQYEBMPFZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluoroiodobenzene?
The canonical SMILES of 4-Fluoroiodobenzene is C1=CC(=CC=C1F)I.
What is the CAS number of 4-Fluoroiodobenzene?
The CAS number of 4-Fluoroiodobenzene is 352-34-1.
What is the European Community (EC) number of 4-Fluoroiodobenzene?
The European Community (EC) number of 4-Fluoroiodobenzene is 206-522-7.
What is the UNII of 4-Fluoroiodobenzene?
The UNII of 4-Fluoroiodobenzene is H2Z2C5X7RW.
Is 4-Fluoroiodobenzene a canonicalized compound?
Yes, 4-Fluoroiodobenzene is a canonicalized compound according to PubChem.