What is the molecular formula of 4-Fluoro-3-methylanisole?
The molecular formula of 4-Fluoro-3-methylanisole is C8H9FO.
What is the molecular weight of 4-Fluoro-3-methylanisole?
The molecular weight of 4-Fluoro-3-methylanisole is 140.15 g/mol.
When was 4-Fluoro-3-methylanisole created?
4-Fluoro-3-methylanisole was created on July 19, 2005.
What is the IUPAC name of 4-Fluoro-3-methylanisole?
The IUPAC name of 4-Fluoro-3-methylanisole is 1-fluoro-4-methoxy-2-methylbenzene.
What is the InChI of 4-Fluoro-3-methylanisole?
The InChI of 4-Fluoro-3-methylanisole is InChI=1S/C8H9FO/c1-6-5-7(10-2)3-4-8(6)9/h3-5H,1-2H3.
What is the InChIKey of 4-Fluoro-3-methylanisole?
The InChIKey of 4-Fluoro-3-methylanisole is XZBXPBDJLUJLEU-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluoro-3-methylanisole?
The canonical SMILES of 4-Fluoro-3-methylanisole is CC1=C(C=CC(=C1)OC)F.
What is the CAS number of 4-Fluoro-3-methylanisole?
The CAS number of 4-Fluoro-3-methylanisole is 2338-54-7.
What is the XLogP3 value of 4-Fluoro-3-methylanisole?
The XLogP3 value of 4-Fluoro-3-methylanisole is 2.
Is 4-Fluoro-3-methylanisole a canonicalized compound?
Yes, 4-Fluoro-3-methylanisole is a canonicalized compound according to PubChem.