What is the molecular formula of 4-Fluoro-2-iodotoluene?
The molecular formula of 4-Fluoro-2-iodotoluene is C7H6FI.
What is the molecular weight of 4-Fluoro-2-iodotoluene?
The molecular weight of 4-Fluoro-2-iodotoluene is 236.02 g/mol.
What is the IUPAC name of 4-Fluoro-2-iodotoluene?
The IUPAC name of 4-Fluoro-2-iodotoluene is 4-fluoro-2-iodo-1-methylbenzene.
What is the InChI code of 4-Fluoro-2-iodotoluene?
The InChI code of 4-Fluoro-2-iodotoluene is InChI=1S/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3.
What is the InChIKey of 4-Fluoro-2-iodotoluene?
The InChIKey of 4-Fluoro-2-iodotoluene is RZGYAMQMAVTAKP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Fluoro-2-iodotoluene?
The canonical SMILES of 4-Fluoro-2-iodotoluene is CC1=C(C=C(C=C1)F)I.
What is the CAS number of 4-Fluoro-2-iodotoluene?
The CAS number of 4-Fluoro-2-iodotoluene is 13194-67-7.
What is the EC number of 4-Fluoro-2-iodotoluene?
The EC number of 4-Fluoro-2-iodotoluene is 236-153-7.
What is the DSSTox Substance ID of 4-Fluoro-2-iodotoluene?
The DSSTox Substance ID of 4-Fluoro-2-iodotoluene is DTXSID40157269.
Is 4-Fluoro-2-iodotoluene a canonicalized compound?
Yes, 4-Fluoro-2-iodotoluene is a canonicalized compound.