What is the molecular formula of 4-Ethylphenethylamine?
The molecular formula of 4-Ethylphenethylamine is C10H15N.
What is the molecular weight of 4-Ethylphenethylamine?
The molecular weight of 4-Ethylphenethylamine is 149.23 g/mol.
What is the IUPAC name of 4-Ethylphenethylamine?
The IUPAC name of 4-Ethylphenethylamine is 2-(4-ethylphenyl)ethanamine.
What is the InChI of 4-Ethylphenethylamine?
The InChI of 4-Ethylphenethylamine is InChI=1S/C10H15N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7-8,11H2,1H3.
What is the InChIKey of 4-Ethylphenethylamine?
The InChIKey of 4-Ethylphenethylamine is XLJAVPNHXCHBPU-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Ethylphenethylamine?
The canonical SMILES of 4-Ethylphenethylamine is CCC1=CC=C(C=C1)CCN.
What is the CAS number of 4-Ethylphenethylamine?
The CAS number of 4-Ethylphenethylamine is 64353-29-3.
What is the XLogP3-AA value of 4-Ethylphenethylamine?
The XLogP3-AA value of 4-Ethylphenethylamine is 2.
How many hydrogen bond donor counts does 4-Ethylphenethylamine have?
4-Ethylphenethylamine has 1 hydrogen bond donor count.
How many rotatable bond counts does 4-Ethylphenethylamine have?
4-Ethylphenethylamine has 3 rotatable bond counts.