What is the molecular formula of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The molecular formula is C10H13BO5.
What are the synonyms of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The synonyms are 911312-76-0, 4-ETHOXYCARBONYL-3-METHOXYPHENYLBORONIC ACID, (4-(Ethoxycarbonyl)-3-methoxyphenyl)boronic acid, (4-ethoxycarbonyl-3-methoxyphenyl)boronic acid, and [4-(Ethoxycarbonyl)-3-methoxyphenyl]boronic acid.
What is the molecular weight of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The molecular weight is 224.02 g/mol.
What is the IUPAC name of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The IUPAC name is (4-ethoxycarbonyl-3-methoxyphenyl)boronic acid.
What is the InChI of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The InChI is InChI=1S/C10H13BO5/c1-3-16-10(12)8-5-4-7(11(13)14)6-9(8)15-2/h4-6,13-14H,3H2,1-2H3.
What is the InChIKey of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The InChIKey is KJSHXBOKHSXLJP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C=C1)C(=O)OCC)OC)(O)O.
What is the CAS number of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The CAS number is 911312-76-0.
What is the hydrogen bond donor count of 4-Ethoxycarbonyl-3-methoxyphenylboronic acid?
The hydrogen bond donor count is 2.
Is 4-Ethoxycarbonyl-3-methoxyphenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.