What is the molecular formula of 4-Dodecyloxybenzoic acid?
The molecular formula of 4-Dodecyloxybenzoic acid is C19H30O3.
What is the molecular weight of 4-Dodecyloxybenzoic acid?
The molecular weight of 4-Dodecyloxybenzoic acid is 306.4 g/mol.
What is the IUPAC Name of 4-Dodecyloxybenzoic acid?
The IUPAC name of 4-Dodecyloxybenzoic acid is 4-dodecoxybenzoic acid.
What is the InChI of 4-Dodecyloxybenzoic acid?
The InChI of 4-Dodecyloxybenzoic acid is InChI=1S/C19H30O3/c1-2-3-4-5-6-7-8-9-10-11-16-22-18-14-12-17(13-15-18)19(20)21/h12-15H,2-11,16H2,1H3,(H,20,21).
What is the InChIKey of 4-Dodecyloxybenzoic acid?
The InChIKey of 4-Dodecyloxybenzoic acid is ALQLYJHDBAKLBB-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Dodecyloxybenzoic acid?
The Canonical SMILES of 4-Dodecyloxybenzoic acid is CCCCCCCCCCCCOC1=CC=C(C=C1)C(=O)O.
What is the CAS number of 4-Dodecyloxybenzoic acid?
The CAS number of 4-Dodecyloxybenzoic acid is 2312-15-4.
What is the XLogP3 value of 4-Dodecyloxybenzoic acid?
The XLogP3 value of 4-Dodecyloxybenzoic acid is 7.1.
What is the hydrogen bond donor count of 4-Dodecyloxybenzoic acid?
The hydrogen bond donor count of 4-Dodecyloxybenzoic acid is 1.
What is the hydrogen bond acceptor count of 4-Dodecyloxybenzoic acid?
The hydrogen bond acceptor count of 4-Dodecyloxybenzoic acid is 3.