The IUPAC name of the compound is [4-(dibenzylamino)-2,6-dimethylphenyl]boronic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 345.2 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C22H24BNO2/c1-17-13-21(14-18(2)22(17)23(25)26)24(15-19-9-5-3-6-10-19)16-20-11-7-4-8-12-20/h3-14,25-26H,15-16H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is UOILFPHQODZYGP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C=C(C=C1C)N(CC2=CC=CC=C2)CC3=CC=CC=C3)C)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1451391-44-8.
What is the hydrogen bond donor count of the compound?
The compound has 2 hydrogen bond donors.
What is the hydrogen bond acceptor count of the compound?
The compound has 3 hydrogen bond acceptors.
How many rotatable bonds does the compound have?
The compound has 6 rotatable bonds.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 43.7Ų.
※ Please kindly note that our products are for research use only.