What is the molecular formula of 4-Chloromethylstilbene?
The molecular formula of 4-Chloromethylstilbene is C15H13Cl.
What are the synonyms of 4-Chloromethylstilbene?
The synonyms of 4-Chloromethylstilbene are 150253-59-1, 4-[(E)-Phenylethenyl)]benzyl chloride, 4-CHLOROMETHYLSTILBENE, and 4-Chloromethylstilbene, predominantly trans.
What is the molecular weight of 4-Chloromethylstilbene?
The molecular weight of 4-Chloromethylstilbene is 228.71 g/mol.
What is the IUPAC name of 4-Chloromethylstilbene?
The IUPAC name of 4-Chloromethylstilbene is 1-(chloromethyl)-4-[(E)-2-phenylethenyl]benzene.
What is the InChI of 4-Chloromethylstilbene?
The InChI of 4-Chloromethylstilbene is InChI=1S/C15H13Cl/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-11H,12H2/b7-6+.
What is the InChIKey of 4-Chloromethylstilbene?
The InChIKey of 4-Chloromethylstilbene is IWJQBYQAGGHNAB-VOTSOKGWSA-N.
What is the canonical SMILES of 4-Chloromethylstilbene?
The canonical SMILES of 4-Chloromethylstilbene is C1=CC=C(C=C1)C=CC2=CC=C(C=C2)CCl.
What is the CAS number of 4-Chloromethylstilbene?
The CAS number of 4-Chloromethylstilbene is 150253-59-1.
Is 4-Chloromethylstilbene a canonicalized compound?
Yes, 4-Chloromethylstilbene is a canonicalized compound.
※ Please kindly note that our products are for research use only.