What is the molecular formula of 4-Chlorobenzylamine?
The molecular formula of 4-Chlorobenzylamine is C7H8ClN.
What is the molecular weight of 4-Chlorobenzylamine?
The molecular weight of 4-Chlorobenzylamine is 141.60 g/mol.
What is the IUPAC name of 4-Chlorobenzylamine?
The IUPAC name of 4-Chlorobenzylamine is (4-chlorophenyl)methanamine.
What is the InChI of 4-Chlorobenzylamine?
The InChI of 4-Chlorobenzylamine is InChI=1S/C7H8ClN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2.
What is the InChIKey of 4-Chlorobenzylamine?
The InChIKey of 4-Chlorobenzylamine is YMVFJGSXZNNUDW-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chlorobenzylamine?
The canonical SMILES of 4-Chlorobenzylamine is C1=CC(=CC=C1CN)Cl.
What is the CAS number of 4-Chlorobenzylamine?
The CAS number of 4-Chlorobenzylamine is 104-86-9.
What is the European Community (EC) number of 4-Chlorobenzylamine?
The European Community (EC) number of 4-Chlorobenzylamine is 203-245-3.
What is the ChEMBL ID of 4-Chlorobenzylamine?
The ChEMBL ID of 4-Chlorobenzylamine is CHEMBL13218.
Is 4-Chlorobenzylamine a canonicalized compound?
Yes, 4-Chlorobenzylamine is a canonicalized compound.