What is the molecular formula of 4-Chloro-2-iodoaniline?
The molecular formula of 4-Chloro-2-iodoaniline is C6H5ClIN.
What are the synonyms of 4-Chloro-2-iodoaniline?
The synonyms of 4-Chloro-2-iodoaniline include 63069-48-7, 2-iodo-4-chloroaniline, 4-Chloro-2-iodo-aniline, and 4-chloro-2-iodo-phenylamine.
What is the molecular weight of 4-Chloro-2-iodoaniline?
The molecular weight of 4-Chloro-2-iodoaniline is 253.47 g/mol.
What is the IUPAC name of 4-Chloro-2-iodoaniline?
The IUPAC name of 4-Chloro-2-iodoaniline is 4-chloro-2-iodoaniline.
What is the InChI of 4-Chloro-2-iodoaniline?
The InChI of 4-Chloro-2-iodoaniline is InChI=1S/C6H5ClIN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2.
What is the InChIKey of 4-Chloro-2-iodoaniline?
The InChIKey of 4-Chloro-2-iodoaniline is FLEJOBRWKBPUOX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-2-iodoaniline?
The canonical SMILES of 4-Chloro-2-iodoaniline is C1=CC(=C(C=C1Cl)I)N.
What is the CAS number of 4-Chloro-2-iodoaniline?
The CAS number of 4-Chloro-2-iodoaniline is 63069-48-7.
What is the European Community (EC) number of 4-Chloro-2-iodoaniline?
The European Community (EC) number of 4-Chloro-2-iodoaniline is 263-839-3.