What is the molecular formula of 4-Butylphenol?
The molecular formula of 4-Butylphenol is C10H14O.
What is the molecular weight of 4-Butylphenol?
The molecular weight of 4-Butylphenol is 150.22 g/mol.
What are some synonyms of 4-Butylphenol?
Some synonyms of 4-Butylphenol include 4-n-Butylphenol, p-Butylphenol, and Phenol, 4-butyl.
What is the IUPAC name of 4-Butylphenol?
The IUPAC name of 4-Butylphenol is 4-butylphenol.
What is the InChI of 4-Butylphenol?
The InChI of 4-Butylphenol is InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3.
What is the InChIKey of 4-Butylphenol?
The InChIKey of 4-Butylphenol is CYYZDBDROVLTJU-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Butylphenol?
The canonical SMILES of 4-Butylphenol is CCCCC1=CC=C(C=C1)O.
What is the CAS number of 4-Butylphenol?
The CAS number of 4-Butylphenol is 1638-22-8.
What is the XLogP3 value of 4-Butylphenol?
The XLogP3 value of 4-Butylphenol is 3.4.
What is the topological polar surface area of 4-Butylphenol?
The topological polar surface area of 4-Butylphenol is 20.2Ų.