What is the molecular formula of 4-Butylaniline according to the reference?
The molecular formula of 4-Butylaniline is C10H15N.
What is the molecular weight of 4-Butylaniline?
The molecular weight of 4-Butylaniline is 149.23 g/mol.
What is the IUPAC name of 4-Butylaniline?
The IUPAC name of 4-Butylaniline is 4-butylaniline.
What is the InChI of 4-Butylaniline?
The InChI of 4-Butylaniline is InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3.
What is the InChIKey of 4-Butylaniline?
The InChIKey of 4-Butylaniline is OGIQUQKNJJTLSZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Butylaniline?
The canonical SMILES of 4-Butylaniline is CCCCC1=CC=C(C=C1)N.
What is the CAS number of 4-Butylaniline?
The CAS number of 4-Butylaniline is 104-13-2.
What is the European Community (EC) number of 4-Butylaniline?
The European Community (EC) number of 4-Butylaniline is 203-177-4.
What is the ChEMBL ID of 4-Butylaniline?
The ChEMBL ID of 4-Butylaniline is CHEMBL3181902.
Is 4-Butylaniline a covalently-bonded unit?
Yes, 4-Butylaniline is a covalently-bonded unit.