What is the molecular formula of 4-Bromothiophenol?
The molecular formula of 4-Bromothiophenol is C6H5BrS.
What is the molecular weight of 4-Bromothiophenol?
The molecular weight of 4-Bromothiophenol is 189.07 g/mol.
What is the IUPAC name of 4-Bromothiophenol?
The IUPAC name of 4-Bromothiophenol is 4-bromobenzenethiol.
What is the InChI of 4-Bromothiophenol?
The InChI of 4-Bromothiophenol is InChI=1S/C6H5BrS/c7-5-1-3-6(8)4-2-5/h1-4,8H.
What is the InChIKey of 4-Bromothiophenol?
The InChIKey of 4-Bromothiophenol is FTBCOQFMQSTCQQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromothiophenol?
The canonical SMILES of 4-Bromothiophenol is C1=CC(=CC=C1S)Br.
What is the CAS number of 4-Bromothiophenol?
The CAS number of 4-Bromothiophenol is 106-53-6.
What is the European Community (EC) number of 4-Bromothiophenol?
The European Community (EC) number of 4-Bromothiophenol is 203-407-3.
What is the ChEMBL ID of 4-Bromothiophenol?
The ChEMBL ID of 4-Bromothiophenol is CHEMBL278240.