What is the molecular formula of 4'-Bromopropiophenone?
The molecular formula of 4'-Bromopropiophenone is C9H9BrO.
What is the synonym for 4'-Bromopropiophenone?
The synonym for 4'-Bromopropiophenone is p-Bromopropiophenone.
What is the molecular weight of 4'-Bromopropiophenone?
The molecular weight of 4'-Bromopropiophenone is 213.07 g/mol.
What is the IUPAC name of 4'-Bromopropiophenone?
The IUPAC name of 4'-Bromopropiophenone is 1-(4-bromophenyl)propan-1-one.
What is the InChI of 4'-Bromopropiophenone?
The InChI of 4'-Bromopropiophenone is InChI=1S/C9H9BrO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3.
What is the InChIKey of 4'-Bromopropiophenone?
The InChIKey of 4'-Bromopropiophenone is UOMOSYFPKGQIKI-UHFFFAOYSA-N.
What is the canonical SMILES of 4'-Bromopropiophenone?
The canonical SMILES of 4'-Bromopropiophenone is CCC(=O)C1=CC=C(C=C1)Br.
What is the CAS number of 4'-Bromopropiophenone?
The CAS number of 4'-Bromopropiophenone is 10342-83-3.
Is 4'-Bromopropiophenone a canonicalized compound?
Yes, 4'-Bromopropiophenone is a canonicalized compound.