What is the molecular formula of 4-Bromophenethyl alcohol?
The molecular formula of 4-Bromophenethyl alcohol is C8H9BrO.
What is the molecular weight of 4-Bromophenethyl alcohol?
The molecular weight of 4-Bromophenethyl alcohol is 201.06 g/mol.
What is the IUPAC name of 4-Bromophenethyl alcohol?
The IUPAC name of 4-Bromophenethyl alcohol is 2-(4-bromophenyl)ethanol.
What is the InChI code of 4-Bromophenethyl alcohol?
The InChI code of 4-Bromophenethyl alcohol is InChI=1S/C8H9BrO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6H2.
What is the InChIKey of 4-Bromophenethyl alcohol?
The InChIKey of 4-Bromophenethyl alcohol is PMOSJSPFNDUAFY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromophenethyl alcohol?
The canonical SMILES of 4-Bromophenethyl alcohol is C1=CC(=CC=C1CCO)Br.
What is the CAS number of 4-Bromophenethyl alcohol?
The CAS number of 4-Bromophenethyl alcohol is 4654-39-1.
What is the European Community (EC) number of 4-Bromophenethyl alcohol?
The European Community (EC) number of 4-Bromophenethyl alcohol is 225-093-7.
What is the DSSTox Substance ID of 4-Bromophenethyl alcohol?
The DSSTox Substance ID of 4-Bromophenethyl alcohol is DTXSID00196871.
Is 4-Bromophenethyl alcohol a canonicalized compound?
Yes, 4-Bromophenethyl alcohol is a canonicalized compound.