What is the molecular formula of 4-Bromoisophthalic acid?
The molecular formula of 4-Bromoisophthalic acid is C8H5BrO4.
What is the molecular weight of 4-Bromoisophthalic acid?
The molecular weight of 4-Bromoisophthalic acid is 245.03 g/mol.
What is the IUPAC name of 4-Bromoisophthalic acid?
The IUPAC name of 4-Bromoisophthalic acid is 4-bromobenzene-1,3-dicarboxylic acid.
What is the InChI of 4-Bromoisophthalic acid?
The InChI of 4-Bromoisophthalic acid is InChI=1S/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13).
What is the InChIKey of 4-Bromoisophthalic acid?
The InChIKey of 4-Bromoisophthalic acid is MSQIEZXCNYUWHN-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromoisophthalic acid?
The canonical SMILES of 4-Bromoisophthalic acid is C1=CC(=C(C=C1C(=O)O)C(=O)O)Br.
What is the CAS number of 4-Bromoisophthalic acid?
The CAS number of 4-Bromoisophthalic acid is 6939-93-1.
What is the European Community (EC) number of 4-Bromoisophthalic acid?
The European Community (EC) number of 4-Bromoisophthalic acid is 230-078-3.
What is the UNII of 4-Bromoisophthalic acid?
The UNII of 4-Bromoisophthalic acid is AB8MA69VHG.