What is the PubChem CID of 4-Bromoindole?
PubChem CID 676494
What is the molecular formula of 4-Bromoindole?
C8H6BrN
What is the molecular weight of 4-Bromoindole?
196.04 g/mol
When was 4-Bromoindole created in PubChem?
It was created on July 7, 2005.
When was 4-Bromoindole last modified in PubChem?
It was last modified on December 30, 2023.
What is the IUPAC name of 4-Bromoindole?
4-bromo-1H-indole
What is the InChI of 4-Bromoindole?
InChI=1S/C8H6BrN/c9-7-2-1-3-8-6(7)4-5-10-8/h1-5,10H
What is the InChIKey of 4-Bromoindole?
GRJZJFUBQYULKL-UHFFFAOYSA-N
What is the canonical SMILES of 4-Bromoindole?
C1=CC2=C(C=CN2)C(=C1)Br
Is 4-Bromoindole a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.