What is the molecular formula of 4-Bromobutyric acid?
The molecular formula of 4-Bromobutyric acid is C4H7BrO2.
What is the molecular weight of 4-Bromobutyric acid?
The molecular weight of 4-Bromobutyric acid is 167.00 g/mol.
What is the IUPAC name of 4-Bromobutyric acid?
The IUPAC name of 4-Bromobutyric acid is 4-bromobutanoic acid.
What is the InChI of 4-Bromobutyric acid?
The InChI of 4-Bromobutyric acid is InChI=1S/C4H7BrO2/c5-3-1-2-4(6)7/h1-3H2,(H,6,7).
What is the InChIKey of 4-Bromobutyric acid?
The InChIKey of 4-Bromobutyric acid is GRHQDJDRGZFIPO-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromobutyric acid?
The canonical SMILES of 4-Bromobutyric acid is C(CC(=O)O)CBr.
What is the CAS number of 4-Bromobutyric acid?
The CAS number of 4-Bromobutyric acid is 2623-87-2.
What is the ChEMBL ID of 4-Bromobutyric acid?
The ChEMBL ID of 4-Bromobutyric acid is CHEMBL1229543.
What is the XLogP3 value of 4-Bromobutyric acid?
The XLogP3 value of 4-Bromobutyric acid is 0.8.
What is the topological polar surface area of 4-Bromobutyric acid?
The topological polar surface area of 4-Bromobutyric acid is 37.3Ų.