What is the molecular formula of 4-Bromo-D-phenylalanine hydrochloride?
The molecular formula of 4-Bromo-D-phenylalanine hydrochloride is C9H11BrClNO2.
What is the molecular weight of 4-Bromo-D-phenylalanine hydrochloride?
The molecular weight of 4-Bromo-D-phenylalanine hydrochloride is 280.54 g/mol.
What is the IUPAC name of 4-Bromo-D-phenylalanine hydrochloride?
The IUPAC name of 4-Bromo-D-phenylalanine hydrochloride is (2R)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride.
What is the InChI of 4-Bromo-D-phenylalanine hydrochloride?
The InChI of 4-Bromo-D-phenylalanine hydrochloride is InChI=1S/C9H10BrNO2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m1./s1.
What is the InChIKey of 4-Bromo-D-phenylalanine hydrochloride?
The InChIKey of 4-Bromo-D-phenylalanine hydrochloride is GRWMPXZZFAPLFZ-DDWIOCJRSA-N.
What is the canonical SMILES of 4-Bromo-D-phenylalanine hydrochloride?
The canonical SMILES of 4-Bromo-D-phenylalanine hydrochloride is C1=CC(=CC=C1CC(C(=O)O)N)Br.Cl.
What is the isomeric SMILES of 4-Bromo-D-phenylalanine hydrochloride?
The isomeric SMILES of 4-Bromo-D-phenylalanine hydrochloride is C1=CC(=CC=C1C[C@H](C(=O)O)N)Br.Cl.
What is the CAS number of 4-Bromo-D-phenylalanine hydrochloride?
The CAS number of 4-Bromo-D-phenylalanine hydrochloride is 122852-33-9.
What is the hydrogen bond donor count of 4-Bromo-D-phenylalanine hydrochloride?
The hydrogen bond donor count of 4-Bromo-D-phenylalanine hydrochloride is 3.
What is the hydrogen bond acceptor count of 4-Bromo-D-phenylalanine hydrochloride?
The hydrogen bond acceptor count of 4-Bromo-D-phenylalanine hydrochloride is 3.
※ Please kindly note that our products are for research use only.