What is the molecular formula of 4-Bromo-5-methylisatin?
The molecular formula is C9H6BrNO2.
What is the molecular weight of 4-Bromo-5-methylisatin?
The molecular weight is 240.05 g/mol.
What is the IUPAC name of 4-Bromo-5-methylisatin?
The IUPAC name is 4-bromo-5-methyl-1H-indole-2,3-dione.
What is the InChI of 4-Bromo-5-methylisatin?
The InChI is InChI=1S/C9H6BrNO2/c1-4-2-3-5-6(7(4)10)8(12)9(13)11-5/h2-3H,1H3,(H,11,12,13).
What is the InChIKey of 4-Bromo-5-methylisatin?
The InChIKey is DKAVQCARZCYRIS-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Bromo-5-methylisatin?
The Canonical SMILES is CC1=C(C2=C(C=C1)NC(=O)C2=O)Br.
What is the CAS number of 4-Bromo-5-methylisatin?
The CAS number is 147149-84-6.
What is the EC number of 4-Bromo-5-methylisatin?
The EC number is 687-910-7.
Is 4-Bromo-5-methylisatin a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.