What is the molecular formula of 4-Bromo-3-nitrotoluene?
The molecular formula of 4-Bromo-3-nitrotoluene is C7H6BrNO2.
What is the molecular weight of 4-Bromo-3-nitrotoluene?
The molecular weight of 4-Bromo-3-nitrotoluene is 216.03 g/mol.
When was 4-Bromo-3-nitrotoluene created?
4-Bromo-3-nitrotoluene was created on March 26, 2005.
What is the IUPAC name of 4-Bromo-3-nitrotoluene?
The IUPAC name of 4-Bromo-3-nitrotoluene is 1-bromo-4-methyl-2-nitrobenzene.
What is the InChI of 4-Bromo-3-nitrotoluene?
The InChI of 4-Bromo-3-nitrotoluene is InChI=1S/C7H6BrNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3.
What is the InChIKey of 4-Bromo-3-nitrotoluene?
The InChIKey of 4-Bromo-3-nitrotoluene is UPBUTKQMDPHQAQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-nitrotoluene?
The canonical SMILES of 4-Bromo-3-nitrotoluene is CC1=CC(=C(C=C1)Br)[N+](=O)[O-].
What is the CAS number of 4-Bromo-3-nitrotoluene?
The CAS number of 4-Bromo-3-nitrotoluene is 5326-34-1.
What is the European Community (EC) number of 4-Bromo-3-nitrotoluene?
The European Community (EC) number of 4-Bromo-3-nitrotoluene is 226-203-6.
What is the XLogP3 value of 4-Bromo-3-nitrotoluene?
The XLogP3 value of 4-Bromo-3-nitrotoluene is 2.9.