What is the molecular formula of 4-Bromo-3-methoxyphenol?
The molecular formula of 4-Bromo-3-methoxyphenol is C7H7BrO2.
What is the molecular weight of 4-Bromo-3-methoxyphenol?
The molecular weight of 4-Bromo-3-methoxyphenol is 203.03 g/mol.
What is the IUPAC name of 4-Bromo-3-methoxyphenol?
The IUPAC name of 4-Bromo-3-methoxyphenol is 4-bromo-3-methoxyphenol.
What is the InChI of 4-Bromo-3-methoxyphenol?
The InChI of 4-Bromo-3-methoxyphenol is InChI=1S/C7H7BrO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,9H,1H3.
What is the InChIKey of 4-Bromo-3-methoxyphenol?
The InChIKey of 4-Bromo-3-methoxyphenol is UYDZUCNMZXCLJI-UHFFFAOYSA-N.
What is the CAS number of 4-Bromo-3-methoxyphenol?
The CAS number of 4-Bromo-3-methoxyphenol is 102127-34-4.
What is the molecular weight of 4-Bromo-3-methoxyphenol calculated by PubChem?
The molecular weight of 4-Bromo-3-methoxyphenol is calculated as 203.03 g/mol by PubChem.
What is the XLogP3 value of 4-Bromo-3-methoxyphenol?
The XLogP3 value of 4-Bromo-3-methoxyphenol is 1.5.
How many hydrogen bond donor counts are there in 4-Bromo-3-methoxyphenol?
There is 1 hydrogen bond donor count in 4-Bromo-3-methoxyphenol.
How many hydrogen bond acceptor counts are there in 4-Bromo-3-methoxyphenol?
There are 2 hydrogen bond acceptor counts in 4-Bromo-3-methoxyphenol.