What is the molecular formula of 4-Bromo-3-methoxyaniline?
The molecular formula of 4-Bromo-3-methoxyaniline is C7H8BrNO.
What is the molecular weight of 4-Bromo-3-methoxyaniline?
The molecular weight of 4-Bromo-3-methoxyaniline is 202.05 g/mol.
What is the IUPAC name of 4-Bromo-3-methoxyaniline?
The IUPAC name of 4-Bromo-3-methoxyaniline is 4-bromo-3-methoxyaniline.
What is the InChI of 4-Bromo-3-methoxyaniline?
The InChI of 4-Bromo-3-methoxyaniline is InChI=1S/C7H8BrNO/c1-10-7-4-5(9)2-3-6(7)8/h2-4H,9H2,1H3.
What is the InChIKey of 4-Bromo-3-methoxyaniline?
The InChIKey of 4-Bromo-3-methoxyaniline is RUTNWXBHRAIQSP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-methoxyaniline?
The canonical SMILES of 4-Bromo-3-methoxyaniline is COC1=C(C=CC(=C1)N)Br.
What is the CAS number of 4-Bromo-3-methoxyaniline?
The CAS number of 4-Bromo-3-methoxyaniline is 19056-40-7.
What is the EC number of 4-Bromo-3-methoxyaniline?
The EC number of 4-Bromo-3-methoxyaniline is 629-064-3.
Is 4-Bromo-3-methoxyaniline considered a canonicalized compound?
Yes, 4-Bromo-3-methoxyaniline is considered a canonicalized compound.