What is the molecular formula of 4-Bromo-3,5-dimethylbenzaldehyde?
The molecular formula of 4-Bromo-3,5-dimethylbenzaldehyde is C9H9BrO.
What are the synonyms for 4-Bromo-3,5-dimethylbenzaldehyde?
The synonyms for 4-Bromo-3,5-dimethylbenzaldehyde are 400822-47-1, Benzaldehyde, 4-bromo-3,5-dimethyl-, MFCD08063822, Benzaldehyde,4-bromo-3,5-dimethyl-.
What is the molecular weight of 4-Bromo-3,5-dimethylbenzaldehyde?
The molecular weight of 4-Bromo-3,5-dimethylbenzaldehyde is 213.07 g/mol.
When was 4-Bromo-3,5-dimethylbenzaldehyde created?
4-Bromo-3,5-dimethylbenzaldehyde was created on December 5, 2007.
When was 4-Bromo-3,5-dimethylbenzaldehyde last modified?
4-Bromo-3,5-dimethylbenzaldehyde was last modified on December 2, 2023.
What is the IUPAC name of 4-Bromo-3,5-dimethylbenzaldehyde?
The IUPAC name of 4-Bromo-3,5-dimethylbenzaldehyde is 4-bromo-3,5-dimethylbenzaldehyde.
What is the InChI of 4-Bromo-3,5-dimethylbenzaldehyde?
The InChI of 4-Bromo-3,5-dimethylbenzaldehyde is InChI=1S/C9H9BrO/c1-6-3-8(5-11)4-7(2)9(6)10/h3-5H,1-2H3.
What is the InChIKey of 4-Bromo-3,5-dimethylbenzaldehyde?
The InChIKey of 4-Bromo-3,5-dimethylbenzaldehyde is USONNBCBJMNJIU-UHFFFAOYSA-N.
What is the canonical SMILES representation of 4-Bromo-3,5-dimethylbenzaldehyde?
The canonical SMILES representation of 4-Bromo-3,5-dimethylbenzaldehyde is CC1=CC(=CC(=C1Br)C)C=O.
What is the CAS number of 4-Bromo-3,5-dimethylbenzaldehyde?
The CAS number of 4-Bromo-3,5-dimethylbenzaldehyde is 400822-47-1.
※ Please kindly note that our products are for research use only.