What is the molecular formula of 4-Bromo-2-methoxyphenol?
The molecular formula of 4-Bromo-2-methoxyphenol is C7H7BrO2.
What is the molecular weight of 4-Bromo-2-methoxyphenol?
The molecular weight of 4-Bromo-2-methoxyphenol is 203.03 g/mol.
What is the IUPAC name of 4-Bromo-2-methoxyphenol?
The IUPAC name of 4-Bromo-2-methoxyphenol is 4-bromo-2-methoxyphenol.
What is the InChI of 4-Bromo-2-methoxyphenol?
The InChI of 4-Bromo-2-methoxyphenol is InChI=1S/C7H7BrO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3.
What is the InChIKey of 4-Bromo-2-methoxyphenol?
The InChIKey of 4-Bromo-2-methoxyphenol is WHSIIJQOEGXWSN-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-methoxyphenol?
The canonical SMILES of 4-Bromo-2-methoxyphenol is COC1=C(C=CC(=C1)Br)O.
What is the CAS number of 4-Bromo-2-methoxyphenol?
The CAS number of 4-Bromo-2-methoxyphenol is 7368-78-7.
What is the European Community (EC) number of 4-Bromo-2-methoxyphenol?
The European Community (EC) number of 4-Bromo-2-methoxyphenol is 629-464-8.
What is the ChEMBL ID of 4-Bromo-2-methoxyphenol?
The ChEMBL ID of 4-Bromo-2-methoxyphenol is CHEMBL3416131.
What is the XLogP3 value of 4-Bromo-2-methoxyphenol?
The XLogP3 value of 4-Bromo-2-methoxyphenol is 1.5.