What is the molecular formula of 4-Bromo-2-ethylaniline?
The molecular formula of 4-Bromo-2-ethylaniline is C8H10BrN.
What is the molecular weight of 4-Bromo-2-ethylaniline?
The molecular weight of 4-Bromo-2-ethylaniline is 200.08 g/mol.
What is the IUPAC name of 4-Bromo-2-ethylaniline?
The IUPAC name of 4-Bromo-2-ethylaniline is 4-bromo-2-ethylaniline.
What is the InChI of 4-Bromo-2-ethylaniline?
The InChI of 4-Bromo-2-ethylaniline is InChI=1S/C8H10BrN/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2,10H2,1H3.
What is the InChIKey of 4-Bromo-2-ethylaniline?
The InChIKey of 4-Bromo-2-ethylaniline is LGOZNQPHTIGMQJ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-ethylaniline?
The canonical SMILES of 4-Bromo-2-ethylaniline is CCC1=C(C=CC(=C1)Br)N.
What is the CAS number of 4-Bromo-2-ethylaniline?
The CAS number of 4-Bromo-2-ethylaniline is 45762-41-2.
What is the XLogP3-AA value of 4-Bromo-2-ethylaniline?
The XLogP3-AA value of 4-Bromo-2-ethylaniline is 2.7.
How many hydrogen bond donor counts does 4-Bromo-2-ethylaniline have?
4-Bromo-2-ethylaniline has 1 hydrogen bond donor count.
How many rotatable bond counts does 4-Bromo-2-ethylaniline have?
4-Bromo-2-ethylaniline has 1 rotatable bond count.