What is the molecular formula of 4-Bromo-2-chloroaniline?
The molecular formula of 4-Bromo-2-chloroaniline is C6H5BrClN.
What is the molecular weight of 4-Bromo-2-chloroaniline?
The molecular weight of 4-Bromo-2-chloroaniline is 206.47 g/mol.
What is the IUPAC name of 4-Bromo-2-chloroaniline?
The IUPAC name of 4-Bromo-2-chloroaniline is 4-bromo-2-chloroaniline.
What is the InChI of 4-Bromo-2-chloroaniline?
The InChI of 4-Bromo-2-chloroaniline is InChI=1S/C6H5BrClN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2.
What is the InChIKey of 4-Bromo-2-chloroaniline?
The InChIKey of 4-Bromo-2-chloroaniline is INMZDDDQLHKGPF-UHFFFAOYSA-N.
What is the CAS number of 4-Bromo-2-chloroaniline?
The CAS number of 4-Bromo-2-chloroaniline is 38762-41-3.
What is the European Community (EC) number of 4-Bromo-2-chloroaniline?
The European Community (EC) number of 4-Bromo-2-chloroaniline is 254-118-4.
What is the DSSTox Substance ID of 4-Bromo-2-chloroaniline?
The DSSTox Substance ID of 4-Bromo-2-chloroaniline is DTXSID401027990.
What is the XLogP3 value of 4-Bromo-2-chloroaniline?
The XLogP3 value of 4-Bromo-2-chloroaniline is 3.
Is 4-Bromo-2-chloroaniline a canonicalized compound?
Yes, 4-Bromo-2-chloroaniline is a canonicalized compound according to PubChem.