What is the molecular formula of 4-Bromo-1-indanone?
The molecular formula of 4-Bromo-1-indanone is C9H7BrO.
What is the molecular weight of 4-Bromo-1-indanone?
The molecular weight of 4-Bromo-1-indanone is 211.05 g/mol.
What is the IUPAC name of 4-Bromo-1-indanone?
The IUPAC name of 4-Bromo-1-indanone is 4-bromo-2,3-dihydroinden-1-one.
What is the InChI of 4-Bromo-1-indanone?
The InChI of 4-Bromo-1-indanone is InChI=1S/C9H7BrO/c10-8-3-1-2-7-6(8)4-5-9(7)11/h1-3H,4-5H2.
What is the InChIKey of 4-Bromo-1-indanone?
The InChIKey of 4-Bromo-1-indanone is UVVYFYLSZIMKMC-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-1-indanone?
The canonical SMILES of 4-Bromo-1-indanone is C1CC(=O)C2=C1C(=CC=C2)Br.
What is the CAS number of 4-Bromo-1-indanone?
The CAS number of 4-Bromo-1-indanone is 15115-60-3.
What is the European Community (EC) number of 4-Bromo-1-indanone?
The European Community (EC) number of 4-Bromo-1-indanone is 628-019-5.
How many hydrogen bond donor counts does 4-Bromo-1-indanone have?
4-Bromo-1-indanone has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Bromo-1-indanone have?
4-Bromo-1-indanone has 1 hydrogen bond acceptor count.