What is the molecular formula of 4-Aminophenethyl alcohol?
The molecular formula of 4-Aminophenethyl alcohol is C8H11NO.
What is the molecular weight of 4-Aminophenethyl alcohol?
The molecular weight of 4-Aminophenethyl alcohol is 137.18 g/mol.
What is the IUPAC name of 4-Aminophenethyl alcohol?
The IUPAC name of 4-Aminophenethyl alcohol is 2-(4-aminophenyl)ethanol.
What is the InChI of 4-Aminophenethyl alcohol?
The InChI of 4-Aminophenethyl alcohol is InChI=1S/C8H11NO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6,9H2.
What is the InChIKey of 4-Aminophenethyl alcohol?
The InChIKey of 4-Aminophenethyl alcohol is QXHDYMUPPXAMPQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Aminophenethyl alcohol?
The canonical SMILES of 4-Aminophenethyl alcohol is C1=CC(=CC=C1CCO)N.
What is the CAS number of 4-Aminophenethyl alcohol?
The CAS number of 4-Aminophenethyl alcohol is 104-10-9.
What is the European Community (EC) number of 4-Aminophenethyl alcohol?
The European Community (EC) number of 4-Aminophenethyl alcohol is 203-174-8.
What is the UNII of 4-Aminophenethyl alcohol?
The UNII of 4-Aminophenethyl alcohol is KVH9V2607F.