What is the molecular formula of 4-Aminobenzyl alcohol?
The molecular formula of 4-Aminobenzyl alcohol is C7H9NO.
What is the molecular weight of 4-Aminobenzyl alcohol?
The molecular weight of 4-Aminobenzyl alcohol is 123.15 g/mol.
What is the IUPAC name of 4-Aminobenzyl alcohol?
The IUPAC name of 4-Aminobenzyl alcohol is (4-aminophenyl)methanol.
What is the InChI of 4-Aminobenzyl alcohol?
The InChI of 4-Aminobenzyl alcohol is InChI=1S/C7H9NO/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5,8H2.
What is the InChIKey of 4-Aminobenzyl alcohol?
The InChIKey of 4-Aminobenzyl alcohol is AXKGIPZJYUNAIW-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Aminobenzyl alcohol?
The canonical SMILES of 4-Aminobenzyl alcohol is C1=CC(=CC=C1CO)N.
What is the CAS number of 4-Aminobenzyl alcohol?
The CAS number of 4-Aminobenzyl alcohol is 623-04-1.
What is the European Community (EC) number of 4-Aminobenzyl alcohol?
The European Community (EC) number of 4-Aminobenzyl alcohol is 210-767-5.
What is the ChEMBL ID of 4-Aminobenzyl alcohol?
The ChEMBL ID of 4-Aminobenzyl alcohol is CHEMBL4087737.
Is 4-Aminobenzyl alcohol a canonicalized compound?
Yes, 4-Aminobenzyl alcohol is a canonicalized compound.